C14H21N3O3S — CID 61408535
2-[[3-(methylaminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 61408535) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[[3-(methylaminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[3-(methylaminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 61408535 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[3-(methylaminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CNCc1cccc(NC(=O)NC(CCSC)C(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O3S/c1-15-9-10-4-3-5-11(8-10)16-14(20)17-12(13(18)19)6-7-21-2/h3-5,8,12,15H,6-7,9H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | LDPPSCUJOXWOFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |