C13H15N3O3S — CID 28509770
(2S)-2-[(4-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 28509770) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is (2S)-2-[(4-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(4-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 28509770 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (2S)-2-[(4-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C13H15N3O3S/c1-20-7-6-11(12(17)18)16-13(19)15-10-4-2-9(8-14)3-5-10/h2-5,11H,6-7H2,1H3,(H,17,18)(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | DKFFSOAKRGJHQW-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |