C14H21N3O3S — CID 61203719
(2S)-2-[[4-(dimethylamino)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 61203719) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is (2S)-2-[[4-(dimethylamino)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-(dimethylamino)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 61203719 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-2-[[4-(dimethylamino)phenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1ccc(N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C14H21N3O3S/c1-17(2)11-6-4-10(5-7-11)15-14(20)16-12(13(18)19)8-9-21-3/h4-7,12H,8-9H2,1-3H3,(H,18,19)(H2,15,16,20)/t12-/m0/s1 |
| InChIKey | SYKYPHAZOZJBBQ-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|