C12H17N3O3S — CID 108896964
2-[(4-aminophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108896964) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[(4-aminophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(4-aminophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108896964 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(4-aminophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)Nc1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C12H17N3O3S/c1-19-7-6-10(11(16)17)15-12(18)14-9-4-2-8(13)3-5-9/h2-5,10H,6-7,13H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | WBPCVYYWBKBFMC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|