C15H20N2O4S — CID 663754
methyl (2S)-2-[(4-acetylphenyl)carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 663754) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl (2S)-2-[(4-acetylphenyl)carbamoylamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[(4-acetylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 663754 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl (2S)-2-[(4-acetylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-10(18)11-4-6-12(7-5-11)16-15(20)17-13(8-9-22-3)14(19)21-2/h4-7,13H,8-9H2,1-3H3,(H2,16,17,20)/t13-/m0/s1 |
| InChIKey | RQRDUJVXXNPBDQ-ZDUSSCGKSA-N |
| XLogP | 2.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |