C14H17N3O6 — CID 70431627
methyl 3-acetyloxy-2-[(4-carbamoylphenyl)carbamoylamino]propanoate (PubChem CID 70431627) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is methyl 3-acetyloxy-2-[(4-carbamoylphenyl)carbamoylamino]propanoate.
| Compound Name | methyl 3-acetyloxy-2-[(4-carbamoylphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 70431627 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | methyl 3-acetyloxy-2-[(4-carbamoylphenyl)carbamoylamino]propanoate |
| SMILES | COC(=O)C(COC(C)=O)NC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H17N3O6/c1-8(18)23-7-11(13(20)22-2)17-14(21)16-10-5-3-9(4-6-10)12(15)19/h3-6,11H,7H2,1-2H3,(H2,15,19)(H2,16,17,21) |
| InChIKey | ZXKVNOWOCSCSNA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |