C12H13F3N2O4 — CID 61315744
methyl 3-hydroxy-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanoate (PubChem CID 61315744) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 61315744 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | methyl 3-hydroxy-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanoate |
| SMILES | COC(=O)C(CO)NC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O4/c1-21-10(19)9(6-18)17-11(20)16-8-4-2-7(3-5-8)12(13,14)15/h2-5,9,18H,6H2,1H3,(H2,16,17,20) |
| InChIKey | YWNWRDHAXHKVLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |