About 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea
1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 115712424) has the molecular formula C10H8F6N2O2
and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 115712424 |
| Molecular Formula | C10H8F6N2O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NOCC(F)(F)F)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6N2O2/c11-9(12,13)5-20-18-8(19)17-7-3-1-6(2-4-7)10(14,15)16/h1-4H,5H2,(H2,17,18,19) |
| InChIKey | SOLHLKHGWOECTC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea (CID 115712424) is 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea is O=C(NOCC(F)(F)F)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is SOLHLKHGWOECTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F6N2O2/c11-9(12,13)5-20-18-8(19)17-7-3-1-6(2-4-7)10(14,15)16/h1-4H,5H2,(H2,17,18,19).
What are the key properties of 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea?
1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 302.17 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 115712424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).