C10H8F6N2O2 — CID 115712424
1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 115712424) has the molecular formula C10H8F6N2O2 and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 115712424 |
| Molecular Formula | C10H8F6N2O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NOCC(F)(F)F)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6N2O2/c11-9(12,13)5-20-18-8(19)17-7-3-1-6(2-4-7)10(14,15)16/h1-4H,5H2,(H2,17,18,19) |
| InChIKey | SOLHLKHGWOECTC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|