C10H8F3N3O2 — CID 112700266
1-(4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea (PubChem CID 112700266) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea |
|---|---|
| PubChem CID | 112700266 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea |
| SMILES | N#Cc1ccc(NC(=O)NOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3N3O2/c11-10(12,13)6-18-16-9(17)15-8-3-1-7(5-14)2-4-8/h1-4H,6H2,(H2,15,16,17) |
| InChIKey | VCVLTKVTBBFKEK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|