C14H16F3N3O2 — CID 154930461
1-(2-tert-butyl-4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea (PubChem CID 154930461) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea.
| Compound Name | 1-(2-tert-butyl-4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea |
|---|---|
| PubChem CID | 154930461 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-(2-tert-butyl-4-cyanophenyl)-3-(2,2,2-trifluoroethoxy)urea |
| SMILES | CC(C)(C)c1cc(C#N)ccc1NC(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O2/c1-13(2,3)10-6-9(7-18)4-5-11(10)19-12(21)20-22-8-14(15,16)17/h4-6H,8H2,1-3H3,(H2,19,20,21) |
| InChIKey | PCNDLVUZTHWSNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|