C13H13F3N2O2 — CID 79192157
N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypentanamide (PubChem CID 79192157) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypentanamide.
| Compound Name | N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79192157 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypentanamide |
| SMILES | CC(O)CCC(=O)Nc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2/c1-8(19)2-5-12(20)18-11-4-3-9(7-17)6-10(11)13(14,15)16/h3-4,6,8,19H,2,5H2,1H3,(H,18,20) |
| InChIKey | MWINJMRWIFXYQB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |