C13H14F3N3O — CID 80543421
4-amino-N-[4-cyano-2-(trifluoromethyl)phenyl]-2-methylbutanamide (PubChem CID 80543421) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-amino-N-[4-cyano-2-(trifluoromethyl)phenyl]-2-methylbutanamide.
| Compound Name | 4-amino-N-[4-cyano-2-(trifluoromethyl)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 80543421 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-amino-N-[4-cyano-2-(trifluoromethyl)phenyl]-2-methylbutanamide |
| SMILES | CC(CCN)C(=O)Nc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O/c1-8(4-5-17)12(20)19-11-3-2-9(7-18)6-10(11)13(14,15)16/h2-3,6,8H,4-5,17H2,1H3,(H,19,20) |
| InChIKey | NQFNZOVREUIDEJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |