C12H11F3N2O4S — CID 166224595
2-[(4-cyanophenyl)methylsulfonyl]-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 166224595) has the molecular formula C12H11F3N2O4S and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonyl]-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 166224595 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)CC(=O)NOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N2O4S/c13-12(14,15)8-21-17-11(18)7-22(19,20)6-10-3-1-9(5-16)2-4-10/h1-4H,6-8H2,(H,17,18) |
| InChIKey | NVLSQHHZNDBGME-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|