C19H17F3N2O3S — CID 51956120
2-[(4-cyanophenyl)methylsulfonyl]-N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 51956120) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonyl]-N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 51956120 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CS(=O)(=O)Cc1ccc(C#N)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O3S/c1-13(16-6-8-17(9-7-16)19(20,21)22)24-18(25)12-28(26,27)11-15-4-2-14(10-23)3-5-15/h2-9,13H,11-12H2,1H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | HHVGKDSZCXCJTK-ZDUSSCGKSA-N |
| XLogP | 3.37 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |