C23H19ClN2O3S — CID 55756422
N-[(4-chlorophenyl)-phenylmethyl]-2-[(4-cyanophenyl)methylsulfonyl]acetamide (PubChem CID 55756422) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-phenylmethyl]-2-[(4-cyanophenyl)methylsulfonyl]acetamide.
| Compound Name | N-[(4-chlorophenyl)-phenylmethyl]-2-[(4-cyanophenyl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 55756422 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-[(4-chlorophenyl)-phenylmethyl]-2-[(4-cyanophenyl)methylsulfonyl]acetamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)CC(=O)NC(c2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN2O3S/c24-21-12-10-20(11-13-21)23(19-4-2-1-3-5-19)26-22(27)16-30(28,29)15-18-8-6-17(14-25)7-9-18/h1-13,23H,15-16H2,(H,26,27) |
| InChIKey | FBFJLCKDMQDFRD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |