C15H13BrClNO3S — CID 17225191
N-(2-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide (PubChem CID 17225191) has the molecular formula C15H13BrClNO3S and a molecular weight of 402.70 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 17225191 |
| Molecular Formula | C15H13BrClNO3S |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 400.95 |
| IUPAC Name | N-(2-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(Cl)cc1)Nc1ccccc1Br |
| InChI | InChI=1S/C15H13BrClNO3S/c16-13-3-1-2-4-14(13)18-15(19)10-22(20,21)9-11-5-7-12(17)8-6-11/h1-8H,9-10H2,(H,18,19) |
| InChIKey | IANKMHJMZFSTMQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |