C16H15Cl2NO3S — CID 86926204
N-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]acetamide (PubChem CID 86926204) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 86926204 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]acetamide |
| SMILES | Cc1ccc(CS(=O)(=O)CC(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-11-5-7-12(8-6-11)9-23(21,22)10-15(20)19-14-4-2-3-13(17)16(14)18/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | BDKFSBGQSTWCME-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |