C17H16ClNO5S — CID 17225120
methyl 4-[[2-[(4-chlorophenyl)methylsulfonyl]acetyl]amino]benzoate (PubChem CID 17225120) has the molecular formula C17H16ClNO5S and a molecular weight of 381.84 g/mol. Its IUPAC name is methyl 4-[[2-[(4-chlorophenyl)methylsulfonyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4-chlorophenyl)methylsulfonyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17225120 |
| Molecular Formula | C17H16ClNO5S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | methyl 4-[[2-[(4-chlorophenyl)methylsulfonyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H16ClNO5S/c1-24-17(21)13-4-8-15(9-5-13)19-16(20)11-25(22,23)10-12-2-6-14(18)7-3-12/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | XRTFALUGNRPIRR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |