C18H18NO5S- — CID 7731188
4-[[2-(4-ethylanilino)-2-oxoethyl]sulfonylmethyl]benzoate (PubChem CID 7731188) has the molecular formula C18H18NO5S- and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[[2-(4-ethylanilino)-2-oxoethyl]sulfonylmethyl]benzoate.
| Compound Name | 4-[[2-(4-ethylanilino)-2-oxoethyl]sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 7731188 |
| Molecular Formula | C18H18NO5S- |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[[2-(4-ethylanilino)-2-oxoethyl]sulfonylmethyl]benzoate |
| SMILES | CCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H19NO5S/c1-2-13-5-9-16(10-6-13)19-17(20)12-25(23,24)11-14-3-7-15(8-4-14)18(21)22/h3-10H,2,11-12H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | UIGQBTNBSMLQME-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |