C17H16NO5S- — CID 7731250
3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzoate (PubChem CID 7731250) has the molecular formula C17H16NO5S- and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzoate.
| Compound Name | 3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 7731250 |
| Molecular Formula | C17H16NO5S- |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzoate |
| SMILES | Cc1ccc(NC(=O)CS(=O)(=O)Cc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H17NO5S/c1-12-5-7-15(8-6-12)18-16(19)11-24(22,23)10-13-3-2-4-14(9-13)17(20)21/h2-9H,10-11H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | MXAYPXFEXRGGOO-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |