C24H23FN2O4S — CID 39083783
N-[(4-fluorophenyl)methyl]-3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzamide (PubChem CID 39083783) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzamide |
|---|---|
| PubChem CID | 39083783 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[[2-(4-methylanilino)-2-oxoethyl]sulfonylmethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CS(=O)(=O)Cc2cccc(C(=O)NCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-17-5-11-22(12-6-17)27-23(28)16-32(30,31)15-19-3-2-4-20(13-19)24(29)26-14-18-7-9-21(25)10-8-18/h2-13H,14-16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | DXKFEXVIQYHXRF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |