C11H12NO5S- — CID 6986822
2-[2-(4-methylanilino)-2-oxoethyl]sulfonylacetate (PubChem CID 6986822) has the molecular formula C11H12NO5S- and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[2-(4-methylanilino)-2-oxoethyl]sulfonylacetate.
| Compound Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfonylacetate |
|---|---|
| PubChem CID | 6986822 |
| Molecular Formula | C11H12NO5S- |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfonylacetate |
| SMILES | Cc1ccc(NC(=O)CS(=O)(=O)CC(=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO5S/c1-8-2-4-9(5-3-8)12-10(13)6-18(16,17)7-11(14)15/h2-5H,6-7H2,1H3,(H,12,13)(H,14,15)/p-1 |
| InChIKey | JAXPBRDOSQOMKN-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |