C22H30N4O4S — CID 2459457
2-[[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide (PubChem CID 2459457) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2459457 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN(C)CC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-5-26(6-2)31(29,30)20-13-11-19(12-14-20)24-22(28)16-25(4)15-21(27)23-18-9-7-17(3)8-10-18/h7-14H,5-6,15-16H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | XUYIGUFLXUXQTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |