C26H31N3O6S2 — CID 126259402
N-[4-(diethylsulfamoyl)phenyl]-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126259402) has the molecular formula C26H31N3O6S2 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126259402 |
| Molecular Formula | C26H31N3O6S2 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN(c2cccc(OC)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O6S2/c1-5-28(6-2)36(31,32)24-16-12-21(13-17-24)27-26(30)19-29(22-8-7-9-23(18-22)35-4)37(33,34)25-14-10-20(3)11-15-25/h7-18H,5-6,19H2,1-4H3,(H,27,30) |
| InChIKey | AYKMEVUYJMFTPE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |