C27H23N3O6S — CID 141328819
2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)-N-(4-phenoxyphenyl)acetamide (PubChem CID 141328819) has the molecular formula C27H23N3O6S and a molecular weight of 517.56 g/mol. Its IUPAC name is 2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 141328819 |
| Molecular Formula | C27H23N3O6S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H23N3O6S/c1-20-10-16-26(17-11-20)37(34,35)29(22-6-5-7-23(18-22)30(32)33)19-27(31)28-21-12-14-25(15-13-21)36-24-8-3-2-4-9-24/h2-18H,19H2,1H3,(H,28,31) |
| InChIKey | YFCVSDOGUSBBLD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|