C26H21N3O6S — CID 30173217
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 30173217) has the molecular formula C26H21N3O6S and a molecular weight of 503.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30173217 |
| Molecular Formula | C26H21N3O6S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O6S/c30-26(27-20-11-17-24(18-12-20)35-23-7-3-1-4-8-23)19-28(21-13-15-22(16-14-21)29(31)32)36(33,34)25-9-5-2-6-10-25/h1-18H,19H2,(H,27,30) |
| InChIKey | STSZMYDIGJZEEQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|