C24H24N4O8S2 — CID 2897695
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 2897695) has the molecular formula C24H24N4O8S2 and a molecular weight of 560.61 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 2897695 |
| Molecular Formula | C24H24N4O8S2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H24N4O8S2/c29-24(25-19-6-12-23(13-7-19)37(32,33)26-14-16-36-17-15-26)18-27(20-8-10-21(11-9-20)28(30)31)38(34,35)22-4-2-1-3-5-22/h1-13H,14-18H2,(H,25,29) |
| InChIKey | UFMPVHQHXQJPGK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|