C25H26N4O9S2 — CID 43893310
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 43893310) has the molecular formula C25H26N4O9S2 and a molecular weight of 590.64 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 43893310 |
| Molecular Formula | C25H26N4O9S2 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N4O9S2/c1-37-24-12-11-22(39(33,34)27-13-15-38-16-14-27)17-23(24)26-25(30)18-28(19-7-9-20(10-8-19)29(31)32)40(35,36)21-5-3-2-4-6-21/h2-12,17H,13-16,18H2,1H3,(H,26,30) |
| InChIKey | NTJXQDSZKYUMKZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|