C24H26N4O8S2 — CID 43902177
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 43902177) has the molecular formula C24H26N4O8S2 and a molecular weight of 562.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43902177 |
| Molecular Formula | C24H26N4O8S2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NC(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O8S2/c1-17(2)26-37(32,33)21-13-14-23(36-3)22(15-21)25-24(29)16-27(18-9-11-19(12-10-18)28(30)31)38(34,35)20-7-5-4-6-8-20/h4-15,17,26H,16H2,1-3H3,(H,25,29) |
| InChIKey | ZMZYXLWJVOBWQD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|