C19H24N4O8S2 — CID 92671719
N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]-2-(N-methylsulfonyl-3-nitroanilino)acetamide (PubChem CID 92671719) has the molecular formula C19H24N4O8S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]-2-(N-methylsulfonyl-3-nitroanilino)acetamide.
| Compound Name | N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]-2-(N-methylsulfonyl-3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 92671719 |
| Molecular Formula | C19H24N4O8S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]-2-(N-methylsulfonyl-3-nitroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NC(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H24N4O8S2/c1-13(2)21-33(29,30)16-8-9-18(31-3)17(11-16)20-19(24)12-22(32(4,27)28)14-6-5-7-15(10-14)23(25)26/h5-11,13,21H,12H2,1-4H3,(H,20,24) |
| InChIKey | OXPBCJMLLVVZDU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|