About potassium 4-ethylbenzoate
potassium 4-ethylbenzoate (PubChem CID 23708087) has the molecular formula C9H9KO2
and a molecular weight of 188.27 g/mol. Its IUPAC name is potassium 4-ethylbenzoate.
Molecular Properties
| Compound Name | potassium 4-ethylbenzoate |
| PubChem CID | 23708087 |
| Molecular Formula | C9H9KO2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | potassium 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C9H10O2.K/c1-2-7-3-5-8(6-4-7)9(10)11;/h3-6H,2H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | HLZUXWUXJJGRBV-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 4-ethylbenzoate?
The IUPAC name of potassium 4-ethylbenzoate (CID 23708087) is potassium 4-ethylbenzoate.
What is the SMILES notation for potassium 4-ethylbenzoate?
The canonical SMILES for potassium 4-ethylbenzoate is CCc1ccc(C(=O)[O-])cc1.[K+].
What is the InChIKey of potassium 4-ethylbenzoate?
The InChIKey is HLZUXWUXJJGRBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O2.K/c1-2-7-3-5-8(6-4-7)9(10)11;/h3-6H,2H2,1H3,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 4-ethylbenzoate?
potassium 4-ethylbenzoate has a molecular weight of 188.27 g/mol, XLogP of -2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-ethylbenzoate is sourced from PubChem (CID 23708087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).