About 4-ethylbenzoyl iodide
4-ethylbenzoyl iodide (PubChem CID 89147367) has the molecular formula C9H9IO
and a molecular weight of 260.07 g/mol. Its IUPAC name is 4-ethylbenzoyl iodide.
Molecular Properties
| Compound Name | 4-ethylbenzoyl iodide |
| PubChem CID | 89147367 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 4-ethylbenzoyl iodide |
| SMILES | CCc1ccc(C(=O)I)cc1 |
| InChI | InChI=1S/C9H9IO/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | QQGGVDKBHVROQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylbenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzoyl iodide?
The IUPAC name of 4-ethylbenzoyl iodide (CID 89147367) is 4-ethylbenzoyl iodide.
What is the SMILES notation for 4-ethylbenzoyl iodide?
The canonical SMILES for 4-ethylbenzoyl iodide is CCc1ccc(C(=O)I)cc1.
What is the InChIKey of 4-ethylbenzoyl iodide?
The InChIKey is QQGGVDKBHVROQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3.
What are the key properties of 4-ethylbenzoyl iodide?
4-ethylbenzoyl iodide has a molecular weight of 260.07 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzoyl iodide is sourced from PubChem (CID 89147367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).