About S-fluoro 4-ethylbenzenecarbothioate
S-fluoro 4-ethylbenzenecarbothioate (PubChem CID 143241500) has the molecular formula C9H9FOS
and a molecular weight of 184.23 g/mol. Its IUPAC name is S-fluoro 4-ethylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-fluoro 4-ethylbenzenecarbothioate |
| PubChem CID | 143241500 |
| Molecular Formula | C9H9FOS |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | S-fluoro 4-ethylbenzenecarbothioate |
| SMILES | CCc1ccc(C(=O)SF)cc1 |
| InChI | InChI=1S/C9H9FOS/c1-2-7-3-5-8(6-4-7)9(11)12-10/h3-6H,2H2,1H3 |
| InChIKey | IRHVRFUJEBUWFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-fluoro 4-ethylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-fluoro 4-ethylbenzenecarbothioate?
The IUPAC name of S-fluoro 4-ethylbenzenecarbothioate (CID 143241500) is S-fluoro 4-ethylbenzenecarbothioate.
What is the SMILES notation for S-fluoro 4-ethylbenzenecarbothioate?
The canonical SMILES for S-fluoro 4-ethylbenzenecarbothioate is CCc1ccc(C(=O)SF)cc1.
What is the InChIKey of S-fluoro 4-ethylbenzenecarbothioate?
The InChIKey is IRHVRFUJEBUWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FOS/c1-2-7-3-5-8(6-4-7)9(11)12-10/h3-6H,2H2,1H3.
What are the key properties of S-fluoro 4-ethylbenzenecarbothioate?
S-fluoro 4-ethylbenzenecarbothioate has a molecular weight of 184.23 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-fluoro 4-ethylbenzenecarbothioate is sourced from PubChem (CID 143241500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).