About S-carbamothioyl 4-ethylbenzenecarbothioate
S-carbamothioyl 4-ethylbenzenecarbothioate (PubChem CID 175301252) has the molecular formula C10H11NOS2
and a molecular weight of 225.34 g/mol. Its IUPAC name is S-carbamothioyl 4-ethylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-carbamothioyl 4-ethylbenzenecarbothioate |
| PubChem CID | 175301252 |
| Molecular Formula | C10H11NOS2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | S-carbamothioyl 4-ethylbenzenecarbothioate |
| SMILES | CCc1ccc(C(=O)SC(N)=S)cc1 |
| InChI | InChI=1S/C10H11NOS2/c1-2-7-3-5-8(6-4-7)9(12)14-10(11)13/h3-6H,2H2,1H3,(H2,11,13) |
| InChIKey | MDINEGPGXGPOEJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-carbamothioyl 4-ethylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-carbamothioyl 4-ethylbenzenecarbothioate?
The IUPAC name of S-carbamothioyl 4-ethylbenzenecarbothioate (CID 175301252) is S-carbamothioyl 4-ethylbenzenecarbothioate.
What is the SMILES notation for S-carbamothioyl 4-ethylbenzenecarbothioate?
The canonical SMILES for S-carbamothioyl 4-ethylbenzenecarbothioate is CCc1ccc(C(=O)SC(N)=S)cc1.
What is the InChIKey of S-carbamothioyl 4-ethylbenzenecarbothioate?
The InChIKey is MDINEGPGXGPOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS2/c1-2-7-3-5-8(6-4-7)9(12)14-10(11)13/h3-6H,2H2,1H3,(H2,11,13).
What are the key properties of S-carbamothioyl 4-ethylbenzenecarbothioate?
S-carbamothioyl 4-ethylbenzenecarbothioate has a molecular weight of 225.34 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-carbamothioyl 4-ethylbenzenecarbothioate is sourced from PubChem (CID 175301252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).