About (Z)-but-2-ene;4-ethylbenzamide
(Z)-but-2-ene;4-ethylbenzamide (PubChem CID 143666599) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is (Z)-but-2-ene;4-ethylbenzamide.
Molecular Properties
| Compound Name | (Z)-but-2-ene;4-ethylbenzamide |
| PubChem CID | 143666599 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (Z)-but-2-ene;4-ethylbenzamide |
| SMILES | C/C=C\C.CCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C9H11NO.C4H8/c1-2-7-3-5-8(6-4-7)9(10)11;1-3-4-2/h3-6H,2H2,1H3,(H2,10,11);3-4H,1-2H3/b;4-3- |
| InChIKey | CGDWNDQDSPLMIO-QGAMPUOQSA-N |
| XLogP | 2.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;4-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;4-ethylbenzamide?
The IUPAC name of (Z)-but-2-ene;4-ethylbenzamide (CID 143666599) is (Z)-but-2-ene;4-ethylbenzamide.
What is the SMILES notation for (Z)-but-2-ene;4-ethylbenzamide?
The canonical SMILES for (Z)-but-2-ene;4-ethylbenzamide is C/C=C\C.CCc1ccc(C(N)=O)cc1.
What is the InChIKey of (Z)-but-2-ene;4-ethylbenzamide?
The InChIKey is CGDWNDQDSPLMIO-QGAMPUOQSA-N. The full InChI is InChI=1S/C9H11NO.C4H8/c1-2-7-3-5-8(6-4-7)9(10)11;1-3-4-2/h3-6H,2H2,1H3,(H2,10,11);3-4H,1-2H3/b;4-3-.
What are the key properties of (Z)-but-2-ene;4-ethylbenzamide?
(Z)-but-2-ene;4-ethylbenzamide has a molecular weight of 205.30 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;4-ethylbenzamide is sourced from PubChem (CID 143666599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).