C16H20N4O2 — CID 68644964
[4-(aminomethyl)phenyl]methanamine;benzene-1,4-dicarboxamide (PubChem CID 68644964) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]methanamine;benzene-1,4-dicarboxamide.
| Compound Name | [4-(aminomethyl)phenyl]methanamine;benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 68644964 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [4-(aminomethyl)phenyl]methanamine;benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.NCc1ccc(CN)cc1 |
| InChI | InChI=1S/C8H8N2O2.C8H12N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;9-5-7-1-2-8(6-10)4-3-7/h1-4H,(H2,9,11)(H2,10,12);1-4H,5-6,9-10H2 |
| InChIKey | GIAYLSAQLLIACQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |