C8H9KN2O2 — CID 174539787
potassium;benzene-1,4-dicarboxamide;hydride (PubChem CID 174539787) has the molecular formula C8H9KN2O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is potassium;benzene-1,4-dicarboxamide;hydride.
| Compound Name | potassium;benzene-1,4-dicarboxamide;hydride |
|---|---|
| PubChem CID | 174539787 |
| Molecular Formula | C8H9KN2O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | potassium;benzene-1,4-dicarboxamide;hydride |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.[H-].[K+] |
| InChI | InChI=1S/C8H8N2O2.K.H/c9-7(11)5-1-2-6(4-3-5)8(10)12;;/h1-4H,(H2,9,11)(H2,10,12);;/q;+1;-1 |
| InChIKey | UWCHQNYDVVFYBI-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |