About 4-aminobenzamide;methanol
4-aminobenzamide;methanol (PubChem CID 144801245) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-aminobenzamide;methanol.
Molecular Properties
| Compound Name | 4-aminobenzamide;methanol |
| PubChem CID | 144801245 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4-aminobenzamide;methanol |
| SMILES | CO.NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C7H8N2O.CH4O/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4H,8H2,(H2,9,10);2H,1H3 |
| InChIKey | DRNYTBMOVUXARW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzamide;methanol?
The IUPAC name of 4-aminobenzamide;methanol (CID 144801245) is 4-aminobenzamide;methanol.
What is the SMILES notation for 4-aminobenzamide;methanol?
The canonical SMILES for 4-aminobenzamide;methanol is CO.NC(=O)c1ccc(N)cc1.
What is the InChIKey of 4-aminobenzamide;methanol?
The InChIKey is DRNYTBMOVUXARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.CH4O/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4H,8H2,(H2,9,10);2H,1H3.
What are the key properties of 4-aminobenzamide;methanol?
4-aminobenzamide;methanol has a molecular weight of 168.20 g/mol, XLogP of -0.02, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzamide;methanol is sourced from PubChem (CID 144801245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).