About 4-chloro(13C)benzamide
4-chloro(13C)benzamide (PubChem CID 175798194) has the molecular formula C7H6ClNO
and a molecular weight of 156.58 g/mol. Its IUPAC name is 4-chloro(13C)benzamide.
Molecular Properties
| Compound Name | 4-chloro(13C)benzamide |
| PubChem CID | 175798194 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 156.58 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 4-chloro(13C)benzamide |
| SMILES | N[13C](=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)/i7+1 |
| InChIKey | BLNVISNJTIRAHF-CDYZYAPPSA-N |
| XLogP | 1.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro(13C)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro(13C)benzamide?
The IUPAC name of 4-chloro(13C)benzamide (CID 175798194) is 4-chloro(13C)benzamide.
What is the SMILES notation for 4-chloro(13C)benzamide?
The canonical SMILES for 4-chloro(13C)benzamide is N[13C](=O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro(13C)benzamide?
The InChIKey is BLNVISNJTIRAHF-CDYZYAPPSA-N. The full InChI is InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)/i7+1.
What are the key properties of 4-chloro(13C)benzamide?
4-chloro(13C)benzamide has a molecular weight of 156.58 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro(13C)benzamide is sourced from PubChem (CID 175798194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).