About chloromethane;4-fluorobenzamide
chloromethane;4-fluorobenzamide (PubChem CID 158476805) has the molecular formula C8H9ClFNO
and a molecular weight of 189.62 g/mol. Its IUPAC name is chloromethane;4-fluorobenzamide.
Molecular Properties
| Compound Name | chloromethane;4-fluorobenzamide |
| PubChem CID | 158476805 |
| Molecular Formula | C8H9ClFNO |
| Molecular Weight | 189.62 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | chloromethane;4-fluorobenzamide |
| SMILES | CCl.NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C7H6FNO.CH3Cl/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4H,(H2,9,10);1H3 |
| InChIKey | HHASDYAGENKKKA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;4-fluorobenzamide?
The IUPAC name of chloromethane;4-fluorobenzamide (CID 158476805) is chloromethane;4-fluorobenzamide.
What is the SMILES notation for chloromethane;4-fluorobenzamide?
The canonical SMILES for chloromethane;4-fluorobenzamide is CCl.NC(=O)c1ccc(F)cc1.
What is the InChIKey of chloromethane;4-fluorobenzamide?
The InChIKey is HHASDYAGENKKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO.CH3Cl/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4H,(H2,9,10);1H3.
What are the key properties of chloromethane;4-fluorobenzamide?
chloromethane;4-fluorobenzamide has a molecular weight of 189.62 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;4-fluorobenzamide is sourced from PubChem (CID 158476805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).