C11H10FNO5 — CID 69010186
(E)-but-2-enedioic acid;4-fluorobenzamide (PubChem CID 69010186) has the molecular formula C11H10FNO5 and a molecular weight of 255.20 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-fluorobenzamide.
| Compound Name | (E)-but-2-enedioic acid;4-fluorobenzamide |
|---|---|
| PubChem CID | 69010186 |
| Molecular Formula | C11H10FNO5 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (E)-but-2-enedioic acid;4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H6FNO.C4H4O4/c8-6-3-1-5(2-4-6)7(9)10;5-3(6)1-2-4(7)8/h1-4H,(H2,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UIVWLIXBDOLHAE-WLHGVMLRSA-N |
| XLogP | 0.64 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|