C11H8ClFO2 — CID 121224628
(2E,4Z)-5-chloro-5-(4-fluorophenyl)penta-2,4-dienoic acid (PubChem CID 121224628) has the molecular formula C11H8ClFO2 and a molecular weight of 226.63 g/mol. Its IUPAC name is (2E,4Z)-5-chloro-5-(4-fluorophenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-chloro-5-(4-fluorophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 121224628 |
| Molecular Formula | C11H8ClFO2 |
| Molecular Weight | 226.63 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | (2E,4Z)-5-chloro-5-(4-fluorophenyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C(\Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H8ClFO2/c12-10(2-1-3-11(14)15)8-4-6-9(13)7-5-8/h1-7H,(H,14,15)/b3-1+,10-2- |
| InChIKey | KBLMVZJWTRUTQA-PGSNLPAFSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|