C17H12F2O2 — CID 54369783
5,5-bis(3-fluorophenyl)penta-2,4-dienoic acid (PubChem CID 54369783) has the molecular formula C17H12F2O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 5,5-bis(3-fluorophenyl)penta-2,4-dienoic acid.
| Compound Name | 5,5-bis(3-fluorophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54369783 |
| Molecular Formula | C17H12F2O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5,5-bis(3-fluorophenyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=C(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H12F2O2/c18-14-6-1-4-12(10-14)16(8-3-9-17(20)21)13-5-2-7-15(19)11-13/h1-11H,(H,20,21) |
| InChIKey | USIQYILPJJYRPZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|