C19H11F4NO2 — CID 91066712
5-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91066712) has the molecular formula C19H11F4NO2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 5-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91066712 |
| Molecular Formula | C19H11F4NO2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | N#Cc1cc(C(=CC=CC(=O)O)c2ccc(C(F)(F)F)cc2)ccc1F |
| InChI | InChI=1S/C19H11F4NO2/c20-17-9-6-13(10-14(17)11-24)16(2-1-3-18(25)26)12-4-7-15(8-5-12)19(21,22)23/h1-10H,(H,25,26) |
| InChIKey | YUNUIMQEJMYFOH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|