C18H14F3NO2 — CID 87600132
(2E,4E)-5-(2-methyl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87600132) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is (2E,4E)-5-(2-methyl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(2-methyl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87600132 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2E,4E)-5-(2-methyl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | Cc1cc(/C(=C/C=C/C(=O)O)c2ccc(C(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C18H14F3NO2/c1-12-11-14(9-10-22-12)16(3-2-4-17(23)24)13-5-7-15(8-6-13)18(19,20)21/h2-11H,1H3,(H,23,24)/b4-2+,16-3+ |
| InChIKey | YVNKDYRSXGDEQZ-SIXPYBTNSA-N |
| XLogP | 4.48 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|