C22H21F3N2O2 — CID 91178919
5-(2-piperidin-1-yl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91178919) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 5-(2-piperidin-1-yl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-(2-piperidin-1-yl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91178919 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 5-(2-piperidin-1-yl-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)18-9-7-16(8-10-18)19(5-4-6-21(28)29)17-11-12-26-20(15-17)27-13-2-1-3-14-27/h4-12,15H,1-3,13-14H2,(H,28,29) |
| InChIKey | RWXJHKVFQRQIQD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|