C22H16F3NO2 — CID 87598766
(2E,4E)-5-(4-pyrrol-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87598766) has the molecular formula C22H16F3NO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is (2E,4E)-5-(4-pyrrol-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(4-pyrrol-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87598766 |
| Molecular Formula | C22H16F3NO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2E,4E)-5-(4-pyrrol-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C(/c1ccc(-n2cccc2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16F3NO2/c23-22(24,25)18-10-6-16(7-11-18)20(4-3-5-21(27)28)17-8-12-19(13-9-17)26-14-1-2-15-26/h1-15H,(H,27,28)/b5-3+,20-4+ |
| InChIKey | TXSCDKPWFAFREX-DINWQBMFSA-N |
| XLogP | 5.57 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|