C18H12F8O2S — CID 91222081
5-[4-(pentafluoro-λ6-sulfanyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91222081) has the molecular formula C18H12F8O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is 5-[4-(pentafluoro-λ6-sulfanyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[4-(pentafluoro-λ6-sulfanyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91222081 |
| Molecular Formula | C18H12F8O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 5-[4-(pentafluoro-λ6-sulfanyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F8O2S/c19-18(20,21)14-8-4-12(5-9-14)16(2-1-3-17(27)28)13-6-10-15(11-7-13)29(22,23,24,25)26/h1-11H,(H,27,28) |
| InChIKey | OKIIIHDFRZKJAQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|