C19H15F3O2S — CID 90829348
5-(4-methylsulfanylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 90829348) has the molecular formula C19H15F3O2S and a molecular weight of 364.39 g/mol. Its IUPAC name is 5-(4-methylsulfanylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-(4-methylsulfanylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90829348 |
| Molecular Formula | C19H15F3O2S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-(4-methylsulfanylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | CSc1ccc(C(=CC=CC(=O)O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H15F3O2S/c1-25-16-11-7-14(8-12-16)17(3-2-4-18(23)24)13-5-9-15(10-6-13)19(20,21)22/h2-12H,1H3,(H,23,24) |
| InChIKey | OZTOTOGCWLQARQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|