C19H15F3O3 — CID 87620296
(2E,4Z)-5-(2-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87620296) has the molecular formula C19H15F3O3 and a molecular weight of 348.32 g/mol. Its IUPAC name is (2E,4Z)-5-(2-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-(2-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87620296 |
| Molecular Formula | C19H15F3O3 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2E,4Z)-5-(2-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | COc1ccccc1/C(=C\C=C\C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3O3/c1-25-17-7-3-2-5-16(17)15(6-4-8-18(23)24)13-9-11-14(12-10-13)19(20,21)22/h2-12H,1H3,(H,23,24)/b8-4+,15-6- |
| InChIKey | USZYHUQVUXZLKC-GOSSNDRJSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|